C16H15ClN4O2 — CID 110874868
1-(3-chlorophenyl)-3-[4-(2-oxoimidazolidin-1-yl)phenyl]urea (PubChem CID 110874868) has the molecular formula C16H15ClN4O2 and a molecular weight of 330.78 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[4-(2-oxoimidazolidin-1-yl)phenyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[4-(2-oxoimidazolidin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 110874868 |
| Molecular Formula | C16H15ClN4O2 |
| Molecular Weight | 330.78 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[4-(2-oxoimidazolidin-1-yl)phenyl]urea |
| SMILES | O=C(Nc1ccc(N2CCNC2=O)cc1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H15ClN4O2/c17-11-2-1-3-13(10-11)20-15(22)19-12-4-6-14(7-5-12)21-9-8-18-16(21)23/h1-7,10H,8-9H2,(H,18,23)(H2,19,20,22) |
| InChIKey | BVYQIKMJVSVJKY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.78 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |