C16H14ClN5O4 — CID 47717037
1-(2-chloro-4-nitrophenyl)-3-[4-(2-oxoimidazolidin-1-yl)phenyl]urea (PubChem CID 47717037) has the molecular formula C16H14ClN5O4 and a molecular weight of 375.77 g/mol. Its IUPAC name is 1-(2-chloro-4-nitrophenyl)-3-[4-(2-oxoimidazolidin-1-yl)phenyl]urea.
| Compound Name | 1-(2-chloro-4-nitrophenyl)-3-[4-(2-oxoimidazolidin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 47717037 |
| Molecular Formula | C16H14ClN5O4 |
| Molecular Weight | 375.77 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 1-(2-chloro-4-nitrophenyl)-3-[4-(2-oxoimidazolidin-1-yl)phenyl]urea |
| SMILES | O=C(Nc1ccc(N2CCNC2=O)cc1)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C16H14ClN5O4/c17-13-9-12(22(25)26)5-6-14(13)20-15(23)19-10-1-3-11(4-2-10)21-8-7-18-16(21)24/h1-6,9H,7-8H2,(H,18,24)(H2,19,20,23) |
| InChIKey | JFAFLDZLGCYLKG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.77 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|