C19H21ClN4O4 — CID 4793201
N-(2-chloro-4-nitrophenyl)-2-(4-morpholin-4-ylanilino)propanamide (PubChem CID 4793201) has the molecular formula C19H21ClN4O4 and a molecular weight of 404.85 g/mol. Its IUPAC name is N-(2-chloro-4-nitrophenyl)-2-(4-morpholin-4-ylanilino)propanamide.
| Compound Name | N-(2-chloro-4-nitrophenyl)-2-(4-morpholin-4-ylanilino)propanamide |
|---|---|
| PubChem CID | 4793201 |
| Molecular Formula | C19H21ClN4O4 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | N-(2-chloro-4-nitrophenyl)-2-(4-morpholin-4-ylanilino)propanamide |
| SMILES | CC(Nc1ccc(N2CCOCC2)cc1)C(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C19H21ClN4O4/c1-13(19(25)22-18-7-6-16(24(26)27)12-17(18)20)21-14-2-4-15(5-3-14)23-8-10-28-11-9-23/h2-7,12-13,21H,8-11H2,1H3,(H,22,25) |
| InChIKey | DUWHQYHYOODPNX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|