C18H21ClN6O4S — CID 16961420
N-(2-chloro-4-nitrophenyl)-2-[(4-cyclopropyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 16961420) has the molecular formula C18H21ClN6O4S and a molecular weight of 452.92 g/mol. Its IUPAC name is N-(2-chloro-4-nitrophenyl)-2-[(4-cyclopropyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | N-(2-chloro-4-nitrophenyl)-2-[(4-cyclopropyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 16961420 |
| Molecular Formula | C18H21ClN6O4S |
| Molecular Weight | 452.92 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | N-(2-chloro-4-nitrophenyl)-2-[(4-cyclopropyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | CC(Sc1nnc(N2CCOCC2)n1C1CC1)C(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C18H21ClN6O4S/c1-11(16(26)20-15-5-4-13(25(27)28)10-14(15)19)30-18-22-21-17(24(18)12-2-3-12)23-6-8-29-9-7-23/h4-5,10-12H,2-3,6-9H2,1H3,(H,20,26) |
| InChIKey | KSZULHYYUGWUOJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 115.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.92 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|