C19H19ClN4O4 — CID 45281513
2-[(1-acetyl-2,3-dihydroindol-5-yl)amino]-N-(2-chloro-4-nitrophenyl)propanamide (PubChem CID 45281513) has the molecular formula C19H19ClN4O4 and a molecular weight of 402.84 g/mol. Its IUPAC name is 2-[(1-acetyl-2,3-dihydroindol-5-yl)amino]-N-(2-chloro-4-nitrophenyl)propanamide.
| Compound Name | 2-[(1-acetyl-2,3-dihydroindol-5-yl)amino]-N-(2-chloro-4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 45281513 |
| Molecular Formula | C19H19ClN4O4 |
| Molecular Weight | 402.84 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 2-[(1-acetyl-2,3-dihydroindol-5-yl)amino]-N-(2-chloro-4-nitrophenyl)propanamide |
| SMILES | CC(=O)N1CCc2cc(NC(C)C(=O)Nc3ccc([N+](=O)[O-])cc3Cl)ccc21 |
| InChI | InChI=1S/C19H19ClN4O4/c1-11(19(26)22-17-5-4-15(24(27)28)10-16(17)20)21-14-3-6-18-13(9-14)7-8-23(18)12(2)25/h3-6,9-11,21H,7-8H2,1-2H3,(H,22,26) |
| InChIKey | NDMFBUDFQVFLRB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.84 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|