C21H25ClN4O3 — CID 25357702
(2S)-N-(2-chloro-4-nitrophenyl)-2-[4-(4-methylpiperidin-1-yl)anilino]propanamide (PubChem CID 25357702) has the molecular formula C21H25ClN4O3 and a molecular weight of 416.91 g/mol. Its IUPAC name is (2S)-N-(2-chloro-4-nitrophenyl)-2-[4-(4-methylpiperidin-1-yl)anilino]propanamide.
| Compound Name | (2S)-N-(2-chloro-4-nitrophenyl)-2-[4-(4-methylpiperidin-1-yl)anilino]propanamide |
|---|---|
| PubChem CID | 25357702 |
| Molecular Formula | C21H25ClN4O3 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | (2S)-N-(2-chloro-4-nitrophenyl)-2-[4-(4-methylpiperidin-1-yl)anilino]propanamide |
| SMILES | CC1CCN(c2ccc(N[C@@H](C)C(=O)Nc3ccc([N+](=O)[O-])cc3Cl)cc2)CC1 |
| InChI | InChI=1S/C21H25ClN4O3/c1-14-9-11-25(12-10-14)17-5-3-16(4-6-17)23-15(2)21(27)24-20-8-7-18(26(28)29)13-19(20)22/h3-8,13-15,23H,9-12H2,1-2H3,(H,24,27)/t15-/m0/s1 |
| InChIKey | HSZNYXPPYQBADE-HNNXBMFYSA-N |
| XLogP | 4.92 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|