C12H13ClN4O4 — CID 95733889
1-(2-chloro-4-nitrophenyl)-3-[(3R)-6-oxopiperidin-3-yl]urea (PubChem CID 95733889) has the molecular formula C12H13ClN4O4 and a molecular weight of 312.71 g/mol. Its IUPAC name is 1-(2-chloro-4-nitrophenyl)-3-[(3R)-6-oxopiperidin-3-yl]urea.
| Compound Name | 1-(2-chloro-4-nitrophenyl)-3-[(3R)-6-oxopiperidin-3-yl]urea |
|---|---|
| PubChem CID | 95733889 |
| Molecular Formula | C12H13ClN4O4 |
| Molecular Weight | 312.71 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 1-(2-chloro-4-nitrophenyl)-3-[(3R)-6-oxopiperidin-3-yl]urea |
| SMILES | O=C1CC[C@@H](NC(=O)Nc2ccc([N+](=O)[O-])cc2Cl)CN1 |
| InChI | InChI=1S/C12H13ClN4O4/c13-9-5-8(17(20)21)2-3-10(9)16-12(19)15-7-1-4-11(18)14-6-7/h2-3,5,7H,1,4,6H2,(H,14,18)(H2,15,16,19)/t7-/m1/s1 |
| InChIKey | BKUTUVTVFKOROS-SSDOTTSWSA-N |
| XLogP | 1.65 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.71 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|