C15H19ClN4O4 — CID 96540285
trans-(1S,2S)-2-[(2-chloro-4-nitrophenyl)carbamoylamino]cycloheptane-1-carboxamide (PubChem CID 96540285) has the molecular formula C15H19ClN4O4 and a molecular weight of 354.79 g/mol. Its IUPAC name is trans-(1S,2S)-2-[(2-chloro-4-nitrophenyl)carbamoylamino]cycloheptane-1-carboxamide.
| Compound Name | trans-(1S,2S)-2-[(2-chloro-4-nitrophenyl)carbamoylamino]cycloheptane-1-carboxamide |
|---|---|
| PubChem CID | 96540285 |
| Molecular Formula | C15H19ClN4O4 |
| Molecular Weight | 354.79 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | trans-(1S,2S)-2-[(2-chloro-4-nitrophenyl)carbamoylamino]cycloheptane-1-carboxamide |
| SMILES | NC(=O)[C@H]1CCCCC[C@@H]1NC(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C15H19ClN4O4/c16-11-8-9(20(23)24)6-7-13(11)19-15(22)18-12-5-3-1-2-4-10(12)14(17)21/h6-8,10,12H,1-5H2,(H2,17,21)(H2,18,19,22)/t10-,12-/m0/s1 |
| InChIKey | DVTUJJVOABWDJI-JQWIXIFHSA-N |
| XLogP | 2.80 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.79 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|