C15H18ClN3O4 — CID 111434456
1-(2-chloro-4-nitrophenyl)-3-[3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]urea (PubChem CID 111434456) has the molecular formula C15H18ClN3O4 and a molecular weight of 339.78 g/mol. Its IUPAC name is 1-(2-chloro-4-nitrophenyl)-3-[3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]urea.
| Compound Name | 1-(2-chloro-4-nitrophenyl)-3-[3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]urea |
|---|---|
| PubChem CID | 111434456 |
| Molecular Formula | C15H18ClN3O4 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 1-(2-chloro-4-nitrophenyl)-3-[3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]urea |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1Cl)NC1C2CCC(C2)C1CO |
| InChI | InChI=1S/C15H18ClN3O4/c16-12-6-10(19(22)23)3-4-13(12)17-15(21)18-14-9-2-1-8(5-9)11(14)7-20/h3-4,6,8-9,11,14,20H,1-2,5,7H2,(H2,17,18,21) |
| InChIKey | XGNYNTHSVNQHSF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|