C17H21F3N2O2 — CID 98220666
1-[(1S,2S,3S,4S)-3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]-3-[2-(2,2,2-trifluoroethyl)phenyl]urea (PubChem CID 98220666) has the molecular formula C17H21F3N2O2 and a molecular weight of 342.36 g/mol. Its IUPAC name is 1-[(1S,2S,3S,4S)-3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]-3-[2-(2,2,2-trifluoroethyl)phenyl]urea.
| Compound Name | 1-[(1S,2S,3S,4S)-3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]-3-[2-(2,2,2-trifluoroethyl)phenyl]urea |
|---|---|
| PubChem CID | 98220666 |
| Molecular Formula | C17H21F3N2O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 1-[(1S,2S,3S,4S)-3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]-3-[2-(2,2,2-trifluoroethyl)phenyl]urea |
| SMILES | O=C(Nc1ccccc1CC(F)(F)F)N[C@H]1[C@H]2CC[C@@H](C2)[C@@H]1CO |
| InChI | InChI=1S/C17H21F3N2O2/c18-17(19,20)8-12-3-1-2-4-14(12)21-16(24)22-15-11-6-5-10(7-11)13(15)9-23/h1-4,10-11,13,15,23H,5-9H2,(H2,21,22,24)/t10-,11-,13-,15-/m0/s1 |
| InChIKey | MKYCQDARIOSMJE-UHXUCMFUSA-N |
| XLogP | 3.32 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |