C14H19F3N2O2 — CID 111475455
1-(1-hydroxypentan-3-yl)-3-[2-(2,2,2-trifluoroethyl)phenyl]urea (PubChem CID 111475455) has the molecular formula C14H19F3N2O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is 1-(1-hydroxypentan-3-yl)-3-[2-(2,2,2-trifluoroethyl)phenyl]urea.
| Compound Name | 1-(1-hydroxypentan-3-yl)-3-[2-(2,2,2-trifluoroethyl)phenyl]urea |
|---|---|
| PubChem CID | 111475455 |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1-(1-hydroxypentan-3-yl)-3-[2-(2,2,2-trifluoroethyl)phenyl]urea |
| SMILES | CCC(CCO)NC(=O)Nc1ccccc1CC(F)(F)F |
| InChI | InChI=1S/C14H19F3N2O2/c1-2-11(7-8-20)18-13(21)19-12-6-4-3-5-10(12)9-14(15,16)17/h3-6,11,20H,2,7-9H2,1H3,(H2,18,19,21) |
| InChIKey | JKAPPFDMVWNSLG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |