C15H19F3N2O3 — CID 111490979
N-(4-hydroxy-2-methylbutyl)-N'-[2-(2,2,2-trifluoroethyl)phenyl]oxamide (PubChem CID 111490979) has the molecular formula C15H19F3N2O3 and a molecular weight of 332.32 g/mol. Its IUPAC name is N-(4-hydroxy-2-methylbutyl)-N'-[2-(2,2,2-trifluoroethyl)phenyl]oxamide.
| Compound Name | N-(4-hydroxy-2-methylbutyl)-N'-[2-(2,2,2-trifluoroethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 111490979 |
| Molecular Formula | C15H19F3N2O3 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-(4-hydroxy-2-methylbutyl)-N'-[2-(2,2,2-trifluoroethyl)phenyl]oxamide |
| SMILES | CC(CCO)CNC(=O)C(=O)Nc1ccccc1CC(F)(F)F |
| InChI | InChI=1S/C15H19F3N2O3/c1-10(6-7-21)9-19-13(22)14(23)20-12-5-3-2-4-11(12)8-15(16,17)18/h2-5,10,21H,6-9H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | WWLAYIDZWQWCDQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|