C11H11F3N2O3 — CID 99636395
N'-methoxy-N-[2-(2,2,2-trifluoroethyl)phenyl]oxamide (PubChem CID 99636395) has the molecular formula C11H11F3N2O3 and a molecular weight of 276.21 g/mol. Its IUPAC name is N'-methoxy-N-[2-(2,2,2-trifluoroethyl)phenyl]oxamide.
| Compound Name | N'-methoxy-N-[2-(2,2,2-trifluoroethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 99636395 |
| Molecular Formula | C11H11F3N2O3 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | N'-methoxy-N-[2-(2,2,2-trifluoroethyl)phenyl]oxamide |
| SMILES | CONC(=O)C(=O)Nc1ccccc1CC(F)(F)F |
| InChI | InChI=1S/C11H11F3N2O3/c1-19-16-10(18)9(17)15-8-5-3-2-4-7(8)6-11(12,13)14/h2-5H,6H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | IQLLEYVIQBCSLF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|