C16H21F3N2O2 — CID 111475461
1-[(1-hydroxycyclohexyl)methyl]-3-[2-(2,2,2-trifluoroethyl)phenyl]urea (PubChem CID 111475461) has the molecular formula C16H21F3N2O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is 1-[(1-hydroxycyclohexyl)methyl]-3-[2-(2,2,2-trifluoroethyl)phenyl]urea.
| Compound Name | 1-[(1-hydroxycyclohexyl)methyl]-3-[2-(2,2,2-trifluoroethyl)phenyl]urea |
|---|---|
| PubChem CID | 111475461 |
| Molecular Formula | C16H21F3N2O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-[(1-hydroxycyclohexyl)methyl]-3-[2-(2,2,2-trifluoroethyl)phenyl]urea |
| SMILES | O=C(NCC1(O)CCCCC1)Nc1ccccc1CC(F)(F)F |
| InChI | InChI=1S/C16H21F3N2O2/c17-16(18,19)10-12-6-2-3-7-13(12)21-14(22)20-11-15(23)8-4-1-5-9-15/h2-3,6-7,23H,1,4-5,8-11H2,(H2,20,21,22) |
| InChIKey | QOZUEDHZGSAQCT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |