C15H23NO — CID 60901849
1-[(2-ethylanilino)methyl]cyclohexan-1-ol (PubChem CID 60901849) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 1-[(2-ethylanilino)methyl]cyclohexan-1-ol.
| Compound Name | 1-[(2-ethylanilino)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 60901849 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 1-[(2-ethylanilino)methyl]cyclohexan-1-ol |
| SMILES | CCc1ccccc1NCC1(O)CCCCC1 |
| InChI | InChI=1S/C15H23NO/c1-2-13-8-4-5-9-14(13)16-12-15(17)10-6-3-7-11-15/h4-5,8-9,16-17H,2-3,6-7,10-12H2,1H3 |
| InChIKey | ZFSIFOOYGKZASL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |