C20H24N2O3 — CID 111799039
N-(2-benzylphenyl)-N'-(1-hydroxypentan-3-yl)oxamide (PubChem CID 111799039) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is N-(2-benzylphenyl)-N'-(1-hydroxypentan-3-yl)oxamide.
| Compound Name | N-(2-benzylphenyl)-N'-(1-hydroxypentan-3-yl)oxamide |
|---|---|
| PubChem CID | 111799039 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | N-(2-benzylphenyl)-N'-(1-hydroxypentan-3-yl)oxamide |
| SMILES | CCC(CCO)NC(=O)C(=O)Nc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C20H24N2O3/c1-2-17(12-13-23)21-19(24)20(25)22-18-11-7-6-10-16(18)14-15-8-4-3-5-9-15/h3-11,17,23H,2,12-14H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | AWNHEIHEEJDJEH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|