C18H18ClFN4O3 — CID 47054409
1-[1-(2-chloro-4-nitrophenyl)piperidin-4-yl]-3-(4-fluorophenyl)urea (PubChem CID 47054409) has the molecular formula C18H18ClFN4O3 and a molecular weight of 392.82 g/mol. Its IUPAC name is 1-[1-(2-chloro-4-nitrophenyl)piperidin-4-yl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[1-(2-chloro-4-nitrophenyl)piperidin-4-yl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 47054409 |
| Molecular Formula | C18H18ClFN4O3 |
| Molecular Weight | 392.82 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 1-[1-(2-chloro-4-nitrophenyl)piperidin-4-yl]-3-(4-fluorophenyl)urea |
| SMILES | O=C(Nc1ccc(F)cc1)NC1CCN(c2ccc([N+](=O)[O-])cc2Cl)CC1 |
| InChI | InChI=1S/C18H18ClFN4O3/c19-16-11-15(24(26)27)5-6-17(16)23-9-7-14(8-10-23)22-18(25)21-13-3-1-12(20)2-4-13/h1-6,11,14H,7-10H2,(H2,21,22,25) |
| InChIKey | QKLNSNYVBKFADU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.82 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|