C19H20FN5O4 — CID 86947115
2-[3-[(4-fluorophenyl)carbamoylamino]pyrrolidin-1-yl]-N-methyl-5-nitrobenzamide (PubChem CID 86947115) has the molecular formula C19H20FN5O4 and a molecular weight of 401.40 g/mol. Its IUPAC name is 2-[3-[(4-fluorophenyl)carbamoylamino]pyrrolidin-1-yl]-N-methyl-5-nitrobenzamide.
| Compound Name | 2-[3-[(4-fluorophenyl)carbamoylamino]pyrrolidin-1-yl]-N-methyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 86947115 |
| Molecular Formula | C19H20FN5O4 |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 2-[3-[(4-fluorophenyl)carbamoylamino]pyrrolidin-1-yl]-N-methyl-5-nitrobenzamide |
| SMILES | CNC(=O)c1cc([N+](=O)[O-])ccc1N1CCC(NC(=O)Nc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H20FN5O4/c1-21-18(26)16-10-15(25(28)29)6-7-17(16)24-9-8-14(11-24)23-19(27)22-13-4-2-12(20)3-5-13/h2-7,10,14H,8-9,11H2,1H3,(H,21,26)(H2,22,23,27) |
| InChIKey | FATUJOHGZAMJSS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|