C18H16ClFN4O4 — CID 37443463
4-(2-chloro-4-nitrobenzoyl)-N-(4-fluorophenyl)piperazine-1-carboxamide (PubChem CID 37443463) has the molecular formula C18H16ClFN4O4 and a molecular weight of 406.80 g/mol. Its IUPAC name is 4-(2-chloro-4-nitrobenzoyl)-N-(4-fluorophenyl)piperazine-1-carboxamide.
| Compound Name | 4-(2-chloro-4-nitrobenzoyl)-N-(4-fluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 37443463 |
| Molecular Formula | C18H16ClFN4O4 |
| Molecular Weight | 406.80 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 4-(2-chloro-4-nitrobenzoyl)-N-(4-fluorophenyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)N1CCN(C(=O)c2ccc([N+](=O)[O-])cc2Cl)CC1 |
| InChI | InChI=1S/C18H16ClFN4O4/c19-16-11-14(24(27)28)5-6-15(16)17(25)22-7-9-23(10-8-22)18(26)21-13-3-1-12(20)2-4-13/h1-6,11H,7-10H2,(H,21,26) |
| InChIKey | RLBNJZBVKVZPLY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.80 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|