C19H18FN3O3S — CID 9157257
N'-[2-(2-fluorophenyl)sulfanylacetyl]-3-(2-oxopyrrolidin-1-yl)benzohydrazide (PubChem CID 9157257) has the molecular formula C19H18FN3O3S and a molecular weight of 387.44 g/mol. Its IUPAC name is N'-[2-(2-fluorophenyl)sulfanylacetyl]-3-(2-oxopyrrolidin-1-yl)benzohydrazide.
| Compound Name | N'-[2-(2-fluorophenyl)sulfanylacetyl]-3-(2-oxopyrrolidin-1-yl)benzohydrazide |
|---|---|
| PubChem CID | 9157257 |
| Molecular Formula | C19H18FN3O3S |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | N'-[2-(2-fluorophenyl)sulfanylacetyl]-3-(2-oxopyrrolidin-1-yl)benzohydrazide |
| SMILES | O=C(CSc1ccccc1F)NNC(=O)c1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C19H18FN3O3S/c20-15-7-1-2-8-16(15)27-12-17(24)21-22-19(26)13-5-3-6-14(11-13)23-10-4-9-18(23)25/h1-3,5-8,11H,4,9-10,12H2,(H,21,24)(H,22,26) |
| InChIKey | AHCKKCOIXYNVAD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|