C16H11Cl2FO4 — CID 141368661
2-[1-(2,6-dichloro-3-fluorophenyl)ethoxycarbonyl]benzoic acid (PubChem CID 141368661) has the molecular formula C16H11Cl2FO4 and a molecular weight of 357.16 g/mol. Its IUPAC name is 2-[1-(2,6-dichloro-3-fluorophenyl)ethoxycarbonyl]benzoic acid.
| Compound Name | 2-[1-(2,6-dichloro-3-fluorophenyl)ethoxycarbonyl]benzoic acid |
|---|---|
| PubChem CID | 141368661 |
| Molecular Formula | C16H11Cl2FO4 |
| Molecular Weight | 357.16 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | 2-[1-(2,6-dichloro-3-fluorophenyl)ethoxycarbonyl]benzoic acid |
| SMILES | CC(OC(=O)c1ccccc1C(=O)O)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C16H11Cl2FO4/c1-8(13-11(17)6-7-12(19)14(13)18)23-16(22)10-5-3-2-4-9(10)15(20)21/h2-8H,1H3,(H,20,21) |
| InChIKey | OEYWYLNJHXLWDU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.16 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|