C9H9Cl2FO3S — CID 58532496
1-(2,6-dichloro-3-fluorophenyl)ethyl methanesulfonate (PubChem CID 58532496) has the molecular formula C9H9Cl2FO3S and a molecular weight of 287.14 g/mol. Its IUPAC name is 1-(2,6-dichloro-3-fluorophenyl)ethyl methanesulfonate.
| Compound Name | 1-(2,6-dichloro-3-fluorophenyl)ethyl methanesulfonate |
|---|---|
| PubChem CID | 58532496 |
| Molecular Formula | C9H9Cl2FO3S |
| Molecular Weight | 287.14 g/mol |
| Exact Mass | 285.96 |
| IUPAC Name | 1-(2,6-dichloro-3-fluorophenyl)ethyl methanesulfonate |
| SMILES | CC(OS(C)(=O)=O)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C9H9Cl2FO3S/c1-5(15-16(2,13)14)8-6(10)3-4-7(12)9(8)11/h3-5H,1-2H3 |
| InChIKey | OPCWPQMTGTWVDG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.14 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|