C12H12Cl2FN — CID 114415090
N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]but-3-yn-2-amine (PubChem CID 114415090) has the molecular formula C12H12Cl2FN and a molecular weight of 260.14 g/mol. Its IUPAC name is N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]but-3-yn-2-amine.
| Compound Name | N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]but-3-yn-2-amine |
|---|---|
| PubChem CID | 114415090 |
| Molecular Formula | C12H12Cl2FN |
| Molecular Weight | 260.14 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]but-3-yn-2-amine |
| SMILES | C#CC(C)NC(C)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C12H12Cl2FN/c1-4-7(2)16-8(3)11-9(13)5-6-10(15)12(11)14/h1,5-8,16H,2-3H3 |
| InChIKey | PEISNXFKSCCBFU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.14 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|