C15H23Cl2FN2 — CID 63454265
2-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1-N,1-N,3-trimethylbutane-1,2-diamine (PubChem CID 63454265) has the molecular formula C15H23Cl2FN2 and a molecular weight of 321.27 g/mol. Its IUPAC name is 2-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1-N,1-N,3-trimethylbutane-1,2-diamine.
| Compound Name | 2-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1-N,1-N,3-trimethylbutane-1,2-diamine |
|---|---|
| PubChem CID | 63454265 |
| Molecular Formula | C15H23Cl2FN2 |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1-N,1-N,3-trimethylbutane-1,2-diamine |
| SMILES | CC(NC(CN(C)C)C(C)C)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C15H23Cl2FN2/c1-9(2)13(8-20(4)5)19-10(3)14-11(16)6-7-12(18)15(14)17/h6-7,9-10,13,19H,8H2,1-5H3 |
| InChIKey | YRIAFFMZULUVJX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|