C13H19Cl2FN2 — CID 82945746
2-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1-N,1-N-dimethylpropane-1,2-diamine (PubChem CID 82945746) has the molecular formula C13H19Cl2FN2 and a molecular weight of 293.21 g/mol. Its IUPAC name is 2-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1-N,1-N-dimethylpropane-1,2-diamine.
| Compound Name | 2-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1-N,1-N-dimethylpropane-1,2-diamine |
|---|---|
| PubChem CID | 82945746 |
| Molecular Formula | C13H19Cl2FN2 |
| Molecular Weight | 293.21 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 2-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1-N,1-N-dimethylpropane-1,2-diamine |
| SMILES | CC(CN(C)C)NC(C)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C13H19Cl2FN2/c1-8(7-18(3)4)17-9(2)12-10(14)5-6-11(16)13(12)15/h5-6,8-9,17H,7H2,1-4H3 |
| InChIKey | MCFHIDCDLMVRHW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.21 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|