C15H15Cl2FN2 — CID 81402040
(1R)-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1-pyridin-2-ylethanamine (PubChem CID 81402040) has the molecular formula C15H15Cl2FN2 and a molecular weight of 313.20 g/mol. Its IUPAC name is (1R)-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1-pyridin-2-ylethanamine.
| Compound Name | (1R)-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1-pyridin-2-ylethanamine |
|---|---|
| PubChem CID | 81402040 |
| Molecular Formula | C15H15Cl2FN2 |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | (1R)-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1-pyridin-2-ylethanamine |
| SMILES | CC(N[C@H](C)c1ccccn1)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C15H15Cl2FN2/c1-9(13-5-3-4-8-19-13)20-10(2)14-11(16)6-7-12(18)15(14)17/h3-10,20H,1-2H3/t9-,10?/m1/s1 |
| InChIKey | DHCGCRZOWGCLFU-YHMJZVADSA-N |
| XLogP | 4.94 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|