C12H12Cl2FN3 — CID 63001802
1-(2,6-dichloro-3-fluorophenyl)-N-(1H-imidazol-5-ylmethyl)ethanamine (PubChem CID 63001802) has the molecular formula C12H12Cl2FN3 and a molecular weight of 288.15 g/mol. Its IUPAC name is 1-(2,6-dichloro-3-fluorophenyl)-N-(1H-imidazol-5-ylmethyl)ethanamine.
| Compound Name | 1-(2,6-dichloro-3-fluorophenyl)-N-(1H-imidazol-5-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 63001802 |
| Molecular Formula | C12H12Cl2FN3 |
| Molecular Weight | 288.15 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 1-(2,6-dichloro-3-fluorophenyl)-N-(1H-imidazol-5-ylmethyl)ethanamine |
| SMILES | CC(NCc1cnc[nH]1)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C12H12Cl2FN3/c1-7(17-5-8-4-16-6-18-8)11-9(13)2-3-10(15)12(11)14/h2-4,6-7,17H,5H2,1H3,(H,16,18) |
| InChIKey | YMDJRKOWRZVAKY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.15 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|