C13H13Cl2FN2S — CID 103786339
1-(2,6-dichloro-3-fluorophenyl)-N-[(5-methyl-1,3-thiazol-2-yl)methyl]ethanamine (PubChem CID 103786339) has the molecular formula C13H13Cl2FN2S and a molecular weight of 319.23 g/mol. Its IUPAC name is 1-(2,6-dichloro-3-fluorophenyl)-N-[(5-methyl-1,3-thiazol-2-yl)methyl]ethanamine.
| Compound Name | 1-(2,6-dichloro-3-fluorophenyl)-N-[(5-methyl-1,3-thiazol-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 103786339 |
| Molecular Formula | C13H13Cl2FN2S |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 1-(2,6-dichloro-3-fluorophenyl)-N-[(5-methyl-1,3-thiazol-2-yl)methyl]ethanamine |
| SMILES | Cc1cnc(CNC(C)c2c(Cl)ccc(F)c2Cl)s1 |
| InChI | InChI=1S/C13H13Cl2FN2S/c1-7-5-18-11(19-7)6-17-8(2)12-9(14)3-4-10(16)13(12)15/h3-5,8,17H,6H2,1-2H3 |
| InChIKey | HCLWPMFPBRIKPX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|