C11H11Cl3N2 — CID 78991401
2-methyl-3-[(2,3,6-trichlorophenyl)methylamino]propanenitrile (PubChem CID 78991401) has the molecular formula C11H11Cl3N2 and a molecular weight of 277.58 g/mol. Its IUPAC name is 2-methyl-3-[(2,3,6-trichlorophenyl)methylamino]propanenitrile.
| Compound Name | 2-methyl-3-[(2,3,6-trichlorophenyl)methylamino]propanenitrile |
|---|---|
| PubChem CID | 78991401 |
| Molecular Formula | C11H11Cl3N2 |
| Molecular Weight | 277.58 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | 2-methyl-3-[(2,3,6-trichlorophenyl)methylamino]propanenitrile |
| SMILES | CC(C#N)CNCc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C11H11Cl3N2/c1-7(4-15)5-16-6-8-9(12)2-3-10(13)11(8)14/h2-3,7,16H,5-6H2,1H3 |
| InChIKey | XYYYJOSDHNNSBB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.58 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|