C14H21BrN2O3 — CID 103845622
2-[[(4-bromo-3-nitrophenyl)methylamino]methyl]-2-ethylbutan-1-ol (PubChem CID 103845622) has the molecular formula C14H21BrN2O3 and a molecular weight of 345.24 g/mol. Its IUPAC name is 2-[[(4-bromo-3-nitrophenyl)methylamino]methyl]-2-ethylbutan-1-ol.
| Compound Name | 2-[[(4-bromo-3-nitrophenyl)methylamino]methyl]-2-ethylbutan-1-ol |
|---|---|
| PubChem CID | 103845622 |
| Molecular Formula | C14H21BrN2O3 |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 2-[[(4-bromo-3-nitrophenyl)methylamino]methyl]-2-ethylbutan-1-ol |
| SMILES | CCC(CC)(CO)CNCc1ccc(Br)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H21BrN2O3/c1-3-14(4-2,10-18)9-16-8-11-5-6-12(15)13(7-11)17(19)20/h5-7,16,18H,3-4,8-10H2,1-2H3 |
| InChIKey | HDRWPQVRMPWVOL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|