C11H17N5 — CID 66142150
N-[[1-[(3-methylimidazol-4-yl)methyl]imidazol-2-yl]methyl]ethanamine (PubChem CID 66142150) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is N-[[1-[(3-methylimidazol-4-yl)methyl]imidazol-2-yl]methyl]ethanamine.
| Compound Name | N-[[1-[(3-methylimidazol-4-yl)methyl]imidazol-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 66142150 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | N-[[1-[(3-methylimidazol-4-yl)methyl]imidazol-2-yl]methyl]ethanamine |
| SMILES | CCNCc1nccn1Cc1cncn1C |
| InChI | InChI=1S/C11H17N5/c1-3-12-7-11-14-4-5-16(11)8-10-6-13-9-15(10)2/h4-6,9,12H,3,7-8H2,1-2H3 |
| InChIKey | UUQNLZPOJAPEMQ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |