C11H16N4 — CID 66403106
N-methyl-1-[1-[(3-methylimidazol-4-yl)methyl]pyrrol-2-yl]methanamine (PubChem CID 66403106) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is N-methyl-1-[1-[(3-methylimidazol-4-yl)methyl]pyrrol-2-yl]methanamine.
| Compound Name | N-methyl-1-[1-[(3-methylimidazol-4-yl)methyl]pyrrol-2-yl]methanamine |
|---|---|
| PubChem CID | 66403106 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | N-methyl-1-[1-[(3-methylimidazol-4-yl)methyl]pyrrol-2-yl]methanamine |
| SMILES | CNCc1cccn1Cc1cncn1C |
| InChI | InChI=1S/C11H16N4/c1-12-6-10-4-3-5-15(10)8-11-7-13-9-14(11)2/h3-5,7,9,12H,6,8H2,1-2H3 |
| InChIKey | UGSAQLAIJSUQKT-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 34.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |