C10H15N3 — CID 66400963
4-[2-(methylaminomethyl)pyrrol-1-yl]butanenitrile (PubChem CID 66400963) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 4-[2-(methylaminomethyl)pyrrol-1-yl]butanenitrile.
| Compound Name | 4-[2-(methylaminomethyl)pyrrol-1-yl]butanenitrile |
|---|---|
| PubChem CID | 66400963 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 4-[2-(methylaminomethyl)pyrrol-1-yl]butanenitrile |
| SMILES | CNCc1cccn1CCCC#N |
| InChI | InChI=1S/C10H15N3/c1-12-9-10-5-4-8-13(10)7-3-2-6-11/h4-5,8,12H,2-3,7,9H2,1H3 |
| InChIKey | LQAKXBKPYHUJBP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 40.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|