C9H18N6O — CID 107042657
2-[(2-methyltetrazol-5-yl)methylamino]-N-propan-2-ylpropanamide (PubChem CID 107042657) has the molecular formula C9H18N6O and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-[(2-methyltetrazol-5-yl)methylamino]-N-propan-2-ylpropanamide.
| Compound Name | 2-[(2-methyltetrazol-5-yl)methylamino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 107042657 |
| Molecular Formula | C9H18N6O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 2-[(2-methyltetrazol-5-yl)methylamino]-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)C(C)NCc1nnn(C)n1 |
| InChI | InChI=1S/C9H18N6O/c1-6(2)11-9(16)7(3)10-5-8-12-14-15(4)13-8/h6-7,10H,5H2,1-4H3,(H,11,16) |
| InChIKey | KLWRYXOADYWGAR-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |