C8H13N5O2 — CID 107044903
2-cyclopropyl-2-[(2-methyltetrazol-5-yl)methylamino]acetic acid (PubChem CID 107044903) has the molecular formula C8H13N5O2 and a molecular weight of 211.22 g/mol. Its IUPAC name is 2-cyclopropyl-2-[(2-methyltetrazol-5-yl)methylamino]acetic acid.
| Compound Name | 2-cyclopropyl-2-[(2-methyltetrazol-5-yl)methylamino]acetic acid |
|---|---|
| PubChem CID | 107044903 |
| Molecular Formula | C8H13N5O2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 2-cyclopropyl-2-[(2-methyltetrazol-5-yl)methylamino]acetic acid |
| SMILES | Cn1nnc(CNC(C(=O)O)C2CC2)n1 |
| InChI | InChI=1S/C8H13N5O2/c1-13-11-6(10-12-13)4-9-7(8(14)15)5-2-3-5/h5,7,9H,2-4H2,1H3,(H,14,15) |
| InChIKey | NSDPEZOLQAPXGM-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |