C9H16N6O — CID 107042658
N-cyclopropyl-2-[(2-methyltetrazol-5-yl)methylamino]propanamide (PubChem CID 107042658) has the molecular formula C9H16N6O and a molecular weight of 224.27 g/mol. Its IUPAC name is N-cyclopropyl-2-[(2-methyltetrazol-5-yl)methylamino]propanamide.
| Compound Name | N-cyclopropyl-2-[(2-methyltetrazol-5-yl)methylamino]propanamide |
|---|---|
| PubChem CID | 107042658 |
| Molecular Formula | C9H16N6O |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | N-cyclopropyl-2-[(2-methyltetrazol-5-yl)methylamino]propanamide |
| SMILES | CC(NCc1nnn(C)n1)C(=O)NC1CC1 |
| InChI | InChI=1S/C9H16N6O/c1-6(9(16)11-7-3-4-7)10-5-8-12-14-15(2)13-8/h6-7,10H,3-5H2,1-2H3,(H,11,16) |
| InChIKey | ICXPPGFRULQBJR-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |