C11H20ClNO2 — CID 77064604
6-(3-chloroprop-2-enylamino)-2-methylheptanoic acid (PubChem CID 77064604) has the molecular formula C11H20ClNO2 and a molecular weight of 233.74 g/mol. Its IUPAC name is 6-(3-chloroprop-2-enylamino)-2-methylheptanoic acid.
| Compound Name | 6-(3-chloroprop-2-enylamino)-2-methylheptanoic acid |
|---|---|
| PubChem CID | 77064604 |
| Molecular Formula | C11H20ClNO2 |
| Molecular Weight | 233.74 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 6-(3-chloroprop-2-enylamino)-2-methylheptanoic acid |
| SMILES | CC(CCCC(C)C(=O)O)NCC=CCl |
| InChI | InChI=1S/C11H20ClNO2/c1-9(11(14)15)5-3-6-10(2)13-8-4-7-12/h4,7,9-10,13H,3,5-6,8H2,1-2H3,(H,14,15) |
| InChIKey | UFHVAVYDQMNAOU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.74 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |