C13H23N3O2 — CID 65289043
2-methyl-6-[(1-methylpyrazol-4-yl)methylamino]heptanoic acid (PubChem CID 65289043) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-methyl-6-[(1-methylpyrazol-4-yl)methylamino]heptanoic acid.
| Compound Name | 2-methyl-6-[(1-methylpyrazol-4-yl)methylamino]heptanoic acid |
|---|---|
| PubChem CID | 65289043 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 2-methyl-6-[(1-methylpyrazol-4-yl)methylamino]heptanoic acid |
| SMILES | CC(CCCC(C)C(=O)O)NCc1cnn(C)c1 |
| InChI | InChI=1S/C13H23N3O2/c1-10(13(17)18)5-4-6-11(2)14-7-12-8-15-16(3)9-12/h8-11,14H,4-7H2,1-3H3,(H,17,18) |
| InChIKey | YMZNXKMTBZOGJN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |