C16H28N2O2S — CID 82886272
2-[5-[[5-(diethylamino)pentan-2-ylamino]methyl]thiophen-2-yl]acetic acid (PubChem CID 82886272) has the molecular formula C16H28N2O2S and a molecular weight of 312.48 g/mol. Its IUPAC name is 2-[5-[[5-(diethylamino)pentan-2-ylamino]methyl]thiophen-2-yl]acetic acid.
| Compound Name | 2-[5-[[5-(diethylamino)pentan-2-ylamino]methyl]thiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 82886272 |
| Molecular Formula | C16H28N2O2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 2-[5-[[5-(diethylamino)pentan-2-ylamino]methyl]thiophen-2-yl]acetic acid |
| SMILES | CCN(CC)CCCC(C)NCc1ccc(CC(=O)O)s1 |
| InChI | InChI=1S/C16H28N2O2S/c1-4-18(5-2)10-6-7-13(3)17-12-15-9-8-14(21-15)11-16(19)20/h8-9,13,17H,4-7,10-12H2,1-3H3,(H,19,20) |
| InChIKey | BCIVNHFHYIFSJO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |