C15H28N2O2 — CID 64578392
[5-[[5-(diethylamino)pentan-2-ylamino]methyl]furan-2-yl]methanol (PubChem CID 64578392) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is [5-[[5-(diethylamino)pentan-2-ylamino]methyl]furan-2-yl]methanol.
| Compound Name | [5-[[5-(diethylamino)pentan-2-ylamino]methyl]furan-2-yl]methanol |
|---|---|
| PubChem CID | 64578392 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | [5-[[5-(diethylamino)pentan-2-ylamino]methyl]furan-2-yl]methanol |
| SMILES | CCN(CC)CCCC(C)NCc1ccc(CO)o1 |
| InChI | InChI=1S/C15H28N2O2/c1-4-17(5-2)10-6-7-13(3)16-11-14-8-9-15(12-18)19-14/h8-9,13,16,18H,4-7,10-12H2,1-3H3 |
| InChIKey | JMPORFJEODMRGC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 48.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |