C10H17NO4S — CID 64631010
[5-[(1-methylsulfonylpropan-2-ylamino)methyl]furan-2-yl]methanol (PubChem CID 64631010) has the molecular formula C10H17NO4S and a molecular weight of 247.32 g/mol. Its IUPAC name is [5-[(1-methylsulfonylpropan-2-ylamino)methyl]furan-2-yl]methanol.
| Compound Name | [5-[(1-methylsulfonylpropan-2-ylamino)methyl]furan-2-yl]methanol |
|---|---|
| PubChem CID | 64631010 |
| Molecular Formula | C10H17NO4S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | [5-[(1-methylsulfonylpropan-2-ylamino)methyl]furan-2-yl]methanol |
| SMILES | CC(CS(C)(=O)=O)NCc1ccc(CO)o1 |
| InChI | InChI=1S/C10H17NO4S/c1-8(7-16(2,13)14)11-5-9-3-4-10(6-12)15-9/h3-4,8,11-12H,5-7H2,1-2H3 |
| InChIKey | ZOZSHBYMXZGZSC-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |