C9H13Br2NOS — CID 102837210
3-[(4,5-dibromothiophen-2-yl)methylamino]butan-1-ol (PubChem CID 102837210) has the molecular formula C9H13Br2NOS and a molecular weight of 343.08 g/mol. Its IUPAC name is 3-[(4,5-dibromothiophen-2-yl)methylamino]butan-1-ol.
| Compound Name | 3-[(4,5-dibromothiophen-2-yl)methylamino]butan-1-ol |
|---|---|
| PubChem CID | 102837210 |
| Molecular Formula | C9H13Br2NOS |
| Molecular Weight | 343.08 g/mol |
| Exact Mass | 340.91 |
| IUPAC Name | 3-[(4,5-dibromothiophen-2-yl)methylamino]butan-1-ol |
| SMILES | CC(CCO)NCc1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C9H13Br2NOS/c1-6(2-3-13)12-5-7-4-8(10)9(11)14-7/h4,6,12-13H,2-3,5H2,1H3 |
| InChIKey | WDVWJFAQPQCQJZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.08 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |