C7H8Br2N2O2S — CID 102837239
2-[(4,5-dibromothiophen-2-yl)methylamino]oxyacetamide (PubChem CID 102837239) has the molecular formula C7H8Br2N2O2S and a molecular weight of 344.03 g/mol. Its IUPAC name is 2-[(4,5-dibromothiophen-2-yl)methylamino]oxyacetamide.
| Compound Name | 2-[(4,5-dibromothiophen-2-yl)methylamino]oxyacetamide |
|---|---|
| PubChem CID | 102837239 |
| Molecular Formula | C7H8Br2N2O2S |
| Molecular Weight | 344.03 g/mol |
| Exact Mass | 341.87 |
| IUPAC Name | 2-[(4,5-dibromothiophen-2-yl)methylamino]oxyacetamide |
| SMILES | NC(=O)CONCc1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C7H8Br2N2O2S/c8-5-1-4(14-7(5)9)2-11-13-3-6(10)12/h1,11H,2-3H2,(H2,10,12) |
| InChIKey | QMDVPGSBQYIODK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.03 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|