C11H21N3O2S2 — CID 79858515
N-methyl-N-(2-methylsulfonylethyl)-5-(propylaminomethyl)-1,3-thiazol-2-amine (PubChem CID 79858515) has the molecular formula C11H21N3O2S2 and a molecular weight of 291.44 g/mol. Its IUPAC name is N-methyl-N-(2-methylsulfonylethyl)-5-(propylaminomethyl)-1,3-thiazol-2-amine.
| Compound Name | N-methyl-N-(2-methylsulfonylethyl)-5-(propylaminomethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79858515 |
| Molecular Formula | C11H21N3O2S2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | N-methyl-N-(2-methylsulfonylethyl)-5-(propylaminomethyl)-1,3-thiazol-2-amine |
| SMILES | CCCNCc1cnc(N(C)CCS(C)(=O)=O)s1 |
| InChI | InChI=1S/C11H21N3O2S2/c1-4-5-12-8-10-9-13-11(17-10)14(2)6-7-18(3,15)16/h9,12H,4-8H2,1-3H3 |
| InChIKey | RMQLVOUPIFKYIM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|