C15H21N3OS — CID 62752896
N-(4-methoxyphenyl)-N-methyl-5-(propylaminomethyl)-1,3-thiazol-2-amine (PubChem CID 62752896) has the molecular formula C15H21N3OS and a molecular weight of 291.42 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-N-methyl-5-(propylaminomethyl)-1,3-thiazol-2-amine.
| Compound Name | N-(4-methoxyphenyl)-N-methyl-5-(propylaminomethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 62752896 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | N-(4-methoxyphenyl)-N-methyl-5-(propylaminomethyl)-1,3-thiazol-2-amine |
| SMILES | CCCNCc1cnc(N(C)c2ccc(OC)cc2)s1 |
| InChI | InChI=1S/C15H21N3OS/c1-4-9-16-10-14-11-17-15(20-14)18(2)12-5-7-13(19-3)8-6-12/h5-8,11,16H,4,9-10H2,1-3H3 |
| InChIKey | VHYCWYYXMTYANS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|