About 3-[[2-(dimethylamino)-1,3-thiazol-5-yl]methylamino]-2-methylpropan-1-ol
3-[[2-(dimethylamino)-1,3-thiazol-5-yl]methylamino]-2-methylpropan-1-ol (PubChem CID 115592480) has the molecular formula C10H19N3OS
and a molecular weight of 229.35 g/mol. Its IUPAC name is 3-[[2-(dimethylamino)-1,3-thiazol-5-yl]methylamino]-2-methylpropan-1-ol.
Molecular Properties
| Compound Name | 3-[[2-(dimethylamino)-1,3-thiazol-5-yl]methylamino]-2-methylpropan-1-ol |
| PubChem CID | 115592480 |
| Molecular Formula | C10H19N3OS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 3-[[2-(dimethylamino)-1,3-thiazol-5-yl]methylamino]-2-methylpropan-1-ol |
| SMILES | CC(CO)CNCc1cnc(N(C)C)s1 |
| InChI | InChI=1S/C10H19N3OS/c1-8(7-14)4-11-5-9-6-12-10(15-9)13(2)3/h6,8,11,14H,4-5,7H2,1-3H3 |
| InChIKey | YWWQEPKPWWSYAV-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[2-(dimethylamino)-1,3-thiazol-5-yl]methylamino]-2-methylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-(dimethylamino)-1,3-thiazol-5-yl]methylamino]-2-methylpropan-1-ol?
The IUPAC name of 3-[[2-(dimethylamino)-1,3-thiazol-5-yl]methylamino]-2-methylpropan-1-ol (CID 115592480) is 3-[[2-(dimethylamino)-1,3-thiazol-5-yl]methylamino]-2-methylpropan-1-ol.
What is the SMILES notation for 3-[[2-(dimethylamino)-1,3-thiazol-5-yl]methylamino]-2-methylpropan-1-ol?
The canonical SMILES for 3-[[2-(dimethylamino)-1,3-thiazol-5-yl]methylamino]-2-methylpropan-1-ol is CC(CO)CNCc1cnc(N(C)C)s1.
What is the InChIKey of 3-[[2-(dimethylamino)-1,3-thiazol-5-yl]methylamino]-2-methylpropan-1-ol?
The InChIKey is YWWQEPKPWWSYAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3OS/c1-8(7-14)4-11-5-9-6-12-10(15-9)13(2)3/h6,8,11,14H,4-5,7H2,1-3H3.
What are the key properties of 3-[[2-(dimethylamino)-1,3-thiazol-5-yl]methylamino]-2-methylpropan-1-ol?
3-[[2-(dimethylamino)-1,3-thiazol-5-yl]methylamino]-2-methylpropan-1-ol has a molecular weight of 229.35 g/mol, XLogP of 0.93, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(dimethylamino)-1,3-thiazol-5-yl]methylamino]-2-methylpropan-1-ol is sourced from PubChem (CID 115592480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).