C12H21F2N3OS — CID 103081048
5-[[2-(2,2-difluoroethoxy)ethylamino]methyl]-N,N-diethyl-1,3-thiazol-2-amine (PubChem CID 103081048) has the molecular formula C12H21F2N3OS and a molecular weight of 293.38 g/mol. Its IUPAC name is 5-[[2-(2,2-difluoroethoxy)ethylamino]methyl]-N,N-diethyl-1,3-thiazol-2-amine.
| Compound Name | 5-[[2-(2,2-difluoroethoxy)ethylamino]methyl]-N,N-diethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 103081048 |
| Molecular Formula | C12H21F2N3OS |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 5-[[2-(2,2-difluoroethoxy)ethylamino]methyl]-N,N-diethyl-1,3-thiazol-2-amine |
| SMILES | CCN(CC)c1ncc(CNCCOCC(F)F)s1 |
| InChI | InChI=1S/C12H21F2N3OS/c1-3-17(4-2)12-16-8-10(19-12)7-15-5-6-18-9-11(13)14/h8,11,15H,3-7,9H2,1-2H3 |
| InChIKey | DFIRDEYSZSPDIX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|