C16H32N4S — CID 43757506
N-[[2-(diethylamino)-1,3-thiazol-5-yl]methyl]-N',N'-di(propan-2-yl)ethane-1,2-diamine (PubChem CID 43757506) has the molecular formula C16H32N4S and a molecular weight of 312.53 g/mol. Its IUPAC name is N-[[2-(diethylamino)-1,3-thiazol-5-yl]methyl]-N',N'-di(propan-2-yl)ethane-1,2-diamine.
| Compound Name | N-[[2-(diethylamino)-1,3-thiazol-5-yl]methyl]-N',N'-di(propan-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 43757506 |
| Molecular Formula | C16H32N4S |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | N-[[2-(diethylamino)-1,3-thiazol-5-yl]methyl]-N',N'-di(propan-2-yl)ethane-1,2-diamine |
| SMILES | CCN(CC)c1ncc(CNCCN(C(C)C)C(C)C)s1 |
| InChI | InChI=1S/C16H32N4S/c1-7-19(8-2)16-18-12-15(21-16)11-17-9-10-20(13(3)4)14(5)6/h12-14,17H,7-11H2,1-6H3 |
| InChIKey | MRUHEPTUPQOMCM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|