C13H20N4S2 — CID 62197781
N,N-diethyl-5-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]-1,3-thiazol-2-amine (PubChem CID 62197781) has the molecular formula C13H20N4S2 and a molecular weight of 296.46 g/mol. Its IUPAC name is N,N-diethyl-5-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]-1,3-thiazol-2-amine.
| Compound Name | N,N-diethyl-5-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 62197781 |
| Molecular Formula | C13H20N4S2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | N,N-diethyl-5-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]-1,3-thiazol-2-amine |
| SMILES | CCN(CC)c1ncc(CNCCc2nccs2)s1 |
| InChI | InChI=1S/C13H20N4S2/c1-3-17(4-2)13-16-10-11(19-13)9-14-6-5-12-15-7-8-18-12/h7-8,10,14H,3-6,9H2,1-2H3 |
| InChIKey | UCEGOPPWGSTYRY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|