C14H23N5S — CID 104627065
N,N-diethyl-5-[[2-(1-methylpyrazol-3-yl)ethylamino]methyl]-1,3-thiazol-2-amine (PubChem CID 104627065) has the molecular formula C14H23N5S and a molecular weight of 293.44 g/mol. Its IUPAC name is N,N-diethyl-5-[[2-(1-methylpyrazol-3-yl)ethylamino]methyl]-1,3-thiazol-2-amine.
| Compound Name | N,N-diethyl-5-[[2-(1-methylpyrazol-3-yl)ethylamino]methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 104627065 |
| Molecular Formula | C14H23N5S |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | N,N-diethyl-5-[[2-(1-methylpyrazol-3-yl)ethylamino]methyl]-1,3-thiazol-2-amine |
| SMILES | CCN(CC)c1ncc(CNCCc2ccn(C)n2)s1 |
| InChI | InChI=1S/C14H23N5S/c1-4-19(5-2)14-16-11-13(20-14)10-15-8-6-12-7-9-18(3)17-12/h7,9,11,15H,4-6,8,10H2,1-3H3 |
| InChIKey | BJIPLYYYYVQVPT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|